C23H25N3O — CID 95723621
(6-ethyl-2-methylquinolin-4-yl)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone (PubChem CID 95723621) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (6-ethyl-2-methylquinolin-4-yl)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone.
| Compound Name | (6-ethyl-2-methylquinolin-4-yl)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95723621 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (6-ethyl-2-methylquinolin-4-yl)-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone |
| SMILES | CCc1ccc2nc(C)cc(C(=O)N3CCCC[C@@H]3c3cccnc3)c2c1 |
| InChI | InChI=1S/C23H25N3O/c1-3-17-9-10-21-19(14-17)20(13-16(2)25-21)23(27)26-12-5-4-8-22(26)18-7-6-11-24-15-18/h6-7,9-11,13-15,22H,3-5,8,12H2,1-2H3/t22-/m1/s1 |
| InChIKey | FKMNMIPDOUSSSP-JOCHJYFZSA-N |
| XLogP | 4.87 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |