About 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate
2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate (PubChem CID 95724358) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate |
| PubChem CID | 95724358 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCCC[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-20-13-14-21-17(19)18-12-6-5-9-16(18)11-10-15-7-3-2-4-8-15/h2-4,7-8,16H,5-6,9-14H2,1H3/t16-/m1/s1 |
| InChIKey | REWBDAAPPUEZGY-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate?
The IUPAC name of 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate (CID 95724358) is 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate.
What is the SMILES notation for 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate?
The canonical SMILES for 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate is COCCOC(=O)N1CCCC[C@@H]1CCc1ccccc1.
What is the InChIKey of 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate?
The InChIKey is REWBDAAPPUEZGY-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H25NO3/c1-20-13-14-21-17(19)18-12-6-5-9-16(18)11-10-15-7-3-2-4-8-15/h2-4,7-8,16H,5-6,9-14H2,1H3/t16-/m1/s1.
What are the key properties of 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate?
2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate has a molecular weight of 291.39 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (2R)-2-(2-phenylethyl)piperidine-1-carboxylate is sourced from PubChem (CID 95724358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).