C17H26FN3O2S — CID 95724807
1-ethyl-4-[(2S)-2-(4-fluorophenyl)piperidin-1-yl]sulfonylpiperazine (PubChem CID 95724807) has the molecular formula C17H26FN3O2S and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-ethyl-4-[(2S)-2-(4-fluorophenyl)piperidin-1-yl]sulfonylpiperazine.
| Compound Name | 1-ethyl-4-[(2S)-2-(4-fluorophenyl)piperidin-1-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 95724807 |
| Molecular Formula | C17H26FN3O2S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-ethyl-4-[(2S)-2-(4-fluorophenyl)piperidin-1-yl]sulfonylpiperazine |
| SMILES | CCN1CCN(S(=O)(=O)N2CCCC[C@H]2c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H26FN3O2S/c1-2-19-11-13-20(14-12-19)24(22,23)21-10-4-3-5-17(21)15-6-8-16(18)9-7-15/h6-9,17H,2-5,10-14H2,1H3/t17-/m0/s1 |
| InChIKey | XVRJCHSKFRGVNU-KRWDZBQOSA-N |
| XLogP | 2.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |