C16H18F3N3 — CID 95725333
3,5-dimethyl-1-[(3R)-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]pyrazole (PubChem CID 95725333) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-[(3R)-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[(3R)-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]pyrazole |
|---|---|
| PubChem CID | 95725333 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3,5-dimethyl-1-[(3R)-1-[(2,3,4-trifluorophenyl)methyl]pyrrolidin-3-yl]pyrazole |
| SMILES | Cc1cc(C)n([C@@H]2CCN(Cc3ccc(F)c(F)c3F)C2)n1 |
| InChI | InChI=1S/C16H18F3N3/c1-10-7-11(2)22(20-10)13-5-6-21(9-13)8-12-3-4-14(17)16(19)15(12)18/h3-4,7,13H,5-6,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | BWWSYLIEJDIEND-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|