C18H27N3O4 — CID 95726350
2-[(3R)-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-2-oxoacetamide (PubChem CID 95726350) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[(3R)-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(3R)-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 95726350 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-[(3R)-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]piperidin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccc(CCN(C)[C@@H]2CCCN(C(=O)C(N)=O)C2)cc1OC |
| InChI | InChI=1S/C18H27N3O4/c1-20(14-5-4-9-21(12-14)18(23)17(19)22)10-8-13-6-7-15(24-2)16(11-13)25-3/h6-7,11,14H,4-5,8-10,12H2,1-3H3,(H2,19,22)/t14-/m1/s1 |
| InChIKey | XFZBPTGXKSDYMA-CQSZACIVSA-N |
| XLogP | 0.65 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|