C18H29N5O3 — CID 95726530
[(2R)-1-[2-(2-ethoxyethyl)-5-methylpyrazole-3-carbonyl]piperazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 95726530) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [(2R)-1-[2-(2-ethoxyethyl)-5-methylpyrazole-3-carbonyl]piperazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(2R)-1-[2-(2-ethoxyethyl)-5-methylpyrazole-3-carbonyl]piperazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 95726530 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [(2R)-1-[2-(2-ethoxyethyl)-5-methylpyrazole-3-carbonyl]piperazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOCCn1nc(C)cc1C(=O)N1CCNC[C@@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C18H29N5O3/c1-3-26-11-10-23-15(12-14(2)20-23)18(25)22-9-6-19-13-16(22)17(24)21-7-4-5-8-21/h12,16,19H,3-11,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | MXOKEFZVKRIOCD-MRXNPFEDSA-N |
| XLogP | 0.26 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|