About (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane
(5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane (PubChem CID 95726693) has the molecular formula C21H28N4S
and a molecular weight of 368.55 g/mol. Its IUPAC name is (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane |
| PubChem CID | 95726693 |
| Molecular Formula | C21H28N4S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane |
| SMILES | CSc1nccc(N2CC[C@@]3(CCCN(CCc4ccccc4)C3)C2)n1 |
| InChI | InChI=1S/C21H28N4S/c1-26-20-22-12-8-19(23-20)25-15-11-21(17-25)10-5-13-24(16-21)14-9-18-6-3-2-4-7-18/h2-4,6-8,12H,5,9-11,13-17H2,1H3/t21-/m1/s1 |
| InChIKey | WTTLCZKXPIVASH-OAQYLSRUSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane?
The IUPAC name of (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane (CID 95726693) is (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane?
The canonical SMILES for (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane is CSc1nccc(N2CC[C@@]3(CCCN(CCc4ccccc4)C3)C2)n1.
What is the InChIKey of (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane?
The InChIKey is WTTLCZKXPIVASH-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H28N4S/c1-26-20-22-12-8-19(23-20)25-15-11-21(17-25)10-5-13-24(16-21)14-9-18-6-3-2-4-7-18/h2-4,6-8,12H,5,9-11,13-17H2,1H3/t21-/m1/s1.
What are the key properties of (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane?
(5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane has a molecular weight of 368.55 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-(2-methylsulfanylpyrimidin-4-yl)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 95726693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).