C16H18N8O — CID 95727533
(2S)-4-(7H-purin-6-yl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide (PubChem CID 95727533) has the molecular formula C16H18N8O and a molecular weight of 338.38 g/mol. Its IUPAC name is (2S)-4-(7H-purin-6-yl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide.
| Compound Name | (2S)-4-(7H-purin-6-yl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 95727533 |
| Molecular Formula | C16H18N8O |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S)-4-(7H-purin-6-yl)-N-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
| SMILES | O=C(NCc1ccncc1)[C@@H]1CN(c2ncnc3nc[nH]c23)CCN1 |
| InChI | InChI=1S/C16H18N8O/c25-16(19-7-11-1-3-17-4-2-11)12-8-24(6-5-18-12)15-13-14(21-9-20-13)22-10-23-15/h1-4,9-10,12,18H,5-8H2,(H,19,25)(H,20,21,22,23)/t12-/m0/s1 |
| InChIKey | HVQCBJDWJAZHSE-LBPRGKRZSA-N |
| XLogP | -0.16 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |