About (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine
(1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine (PubChem CID 95728045) has the molecular formula C15H17N5O
and a molecular weight of 283.34 g/mol. Its IUPAC name is (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine |
| PubChem CID | 95728045 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine |
| SMILES | C[C@H](c1ccon1)N(C)Cc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H17N5O/c1-12(15-8-9-21-17-15)19(2)10-13-11-20(18-16-13)14-6-4-3-5-7-14/h3-9,11-12H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | KKDRDFOCVPUERG-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine?
The IUPAC name of (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine (CID 95728045) is (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine.
What is the SMILES notation for (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine?
The canonical SMILES for (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine is C[C@H](c1ccon1)N(C)Cc1cn(-c2ccccc2)nn1.
What is the InChIKey of (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine?
The InChIKey is KKDRDFOCVPUERG-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H17N5O/c1-12(15-8-9-21-17-15)19(2)10-13-11-20(18-16-13)14-6-4-3-5-7-14/h3-9,11-12H,10H2,1-2H3/t12-/m1/s1.
What are the key properties of (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine?
(1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine has a molecular weight of 283.34 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-methyl-1-(1,2-oxazol-3-yl)-N-[(1-phenyltriazol-4-yl)methyl]ethanamine is sourced from PubChem (CID 95728045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).