C15H20ClNO3S — CID 95729013
2-(4-chlorophenyl)sulfanyl-1-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]ethanone (PubChem CID 95729013) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 95729013 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(Cl)cc1)N1CCC[C@@](O)(CO)CC1 |
| InChI | InChI=1S/C15H20ClNO3S/c16-12-2-4-13(5-3-12)21-10-14(19)17-8-1-6-15(20,11-18)7-9-17/h2-5,18,20H,1,6-11H2/t15-/m0/s1 |
| InChIKey | DOOGUBZEAWZBEB-HNNXBMFYSA-N |
| XLogP | 2.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |