About 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine
1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine (PubChem CID 95730032) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine |
| PubChem CID | 95730032 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine |
| SMILES | COc1cccc(S(=O)(=O)N2CCOC[C@@H](CN(C)C)C2)c1 |
| InChI | InChI=1S/C15H24N2O4S/c1-16(2)10-13-11-17(7-8-21-12-13)22(18,19)15-6-4-5-14(9-15)20-3/h4-6,9,13H,7-8,10-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | OXHGTEUZXCWORL-ZDUSSCGKSA-N |
| XLogP | 0.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine (CID 95730032) is 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine is COc1cccc(S(=O)(=O)N2CCOC[C@@H](CN(C)C)C2)c1.
What is the InChIKey of 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine?
The InChIKey is OXHGTEUZXCWORL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H24N2O4S/c1-16(2)10-13-11-17(7-8-21-12-13)22(18,19)15-6-4-5-14(9-15)20-3/h4-6,9,13H,7-8,10-12H2,1-3H3/t13-/m0/s1.
What are the key properties of 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine?
1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine has a molecular weight of 328.43 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6S)-4-(3-methoxyphenyl)sulfonyl-1,4-oxazepan-6-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 95730032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).