About cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid
cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 95731321) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 95731321 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC(=O)Nc1cccc([C@H]2C[C@@H](C(=O)O)CC2=O)c1 |
| InChI | InChI=1S/C15H17NO4/c1-2-14(18)16-11-5-3-4-9(6-11)12-7-10(15(19)20)8-13(12)17/h3-6,10,12H,2,7-8H2,1H3,(H,16,18)(H,19,20)/t10-,12-/m1/s1 |
| InChIKey | ZTZFSUWOLAYZPS-ZYHUDNBSSA-N |
| XLogP | 2.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid (CID 95731321) is cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid is CCC(=O)Nc1cccc([C@H]2C[C@@H](C(=O)O)CC2=O)c1.
What is the InChIKey of cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid?
The InChIKey is ZTZFSUWOLAYZPS-ZYHUDNBSSA-N. The full InChI is InChI=1S/C15H17NO4/c1-2-14(18)16-11-5-3-4-9(6-11)12-7-10(15(19)20)8-13(12)17/h3-6,10,12H,2,7-8H2,1H3,(H,16,18)(H,19,20)/t10-,12-/m1/s1.
What are the key properties of cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid?
cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid has a molecular weight of 275.30 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,4R)-3-oxo-4-[3-(propanoylamino)phenyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 95731321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).