C11H23N — CID 95732956
(2R)-N-(cyclobutylmethyl)-3,3-dimethylbutan-2-amine (PubChem CID 95732956) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (2R)-N-(cyclobutylmethyl)-3,3-dimethylbutan-2-amine.
| Compound Name | (2R)-N-(cyclobutylmethyl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 95732956 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (2R)-N-(cyclobutylmethyl)-3,3-dimethylbutan-2-amine |
| SMILES | C[C@@H](NCC1CCC1)C(C)(C)C |
| InChI | InChI=1S/C11H23N/c1-9(11(2,3)4)12-8-10-6-5-7-10/h9-10,12H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | VITSCNHCJDABSH-SECBINFHSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |