C23H21Cl2NO3 — CID 95733665
N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-2-(4-chlorophenoxy)-2-methylpropanamide (PubChem CID 95733665) has the molecular formula C23H21Cl2NO3 and a molecular weight of 430.33 g/mol. Its IUPAC name is N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-2-(4-chlorophenoxy)-2-methylpropanamide.
| Compound Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-2-(4-chlorophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 95733665 |
| Molecular Formula | C23H21Cl2NO3 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-2-(4-chlorophenoxy)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)Nc1ccc(Cl)cc1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H21Cl2NO3/c1-23(2,29-18-11-8-16(24)9-12-18)22(28)26-20-13-10-17(25)14-19(20)21(27)15-6-4-3-5-7-15/h3-14,21,27H,1-2H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | PNSFBUWPTJFYNB-NRFANRHFSA-N |
| XLogP | 5.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |