C27H25N3O2 — CID 95735054
N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4-oxo-4-pyren-1-ylbutanamide (PubChem CID 95735054) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4-oxo-4-pyren-1-ylbutanamide.
| Compound Name | N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4-oxo-4-pyren-1-ylbutanamide |
|---|---|
| PubChem CID | 95735054 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-4-oxo-4-pyren-1-ylbutanamide |
| SMILES | Cc1c([C@@H](C)NC(=O)CCC(=O)c2ccc3ccc4cccc5ccc2c3c45)cnn1C |
| InChI | InChI=1S/C27H25N3O2/c1-16(23-15-28-30(3)17(23)2)29-25(32)14-13-24(31)21-11-9-20-8-7-18-5-4-6-19-10-12-22(21)27(20)26(18)19/h4-12,15-16H,13-14H2,1-3H3,(H,29,32)/t16-/m1/s1 |
| InChIKey | IVEGUPOSNNDVRD-MRXNPFEDSA-N |
| XLogP | 5.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|