C19H26N4O — CID 95736663
5-(4-methylphenyl)-1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]pentan-1-one (PubChem CID 95736663) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]pentan-1-one.
| Compound Name | 5-(4-methylphenyl)-1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 95736663 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 5-(4-methylphenyl)-1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(CCCCC(=O)N2CCC[C@H](n3cncn3)C2)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-16-8-10-17(11-9-16)5-2-3-7-19(24)22-12-4-6-18(13-22)23-15-20-14-21-23/h8-11,14-15,18H,2-7,12-13H2,1H3/t18-/m0/s1 |
| InChIKey | ICLOHCZCQFJQQL-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|