C16H24N4O — CID 95736942
[(1R)-cyclohex-3-en-1-yl]-[(3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]methanone (PubChem CID 95736942) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-[(3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-[(3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95736942 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-[(3S)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nc(C)n([C@H]2CCCN(C(=O)[C@H]3CC=CCC3)C2)n1 |
| InChI | InChI=1S/C16H24N4O/c1-12-17-13(2)20(18-12)15-9-6-10-19(11-15)16(21)14-7-4-3-5-8-14/h3-4,14-15H,5-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | GSXIHNIPMBIPQT-GJZGRUSLSA-N |
| XLogP | 2.41 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|