C18H23N3O — CID 95737521
2-(2,5-dimethylphenyl)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]acetamide (PubChem CID 95737521) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]acetamide |
|---|---|
| PubChem CID | 95737521 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)N[C@H]2CCc3nc(C)cn3C2)c1 |
| InChI | InChI=1S/C18H23N3O/c1-12-4-5-13(2)15(8-12)9-18(22)20-16-6-7-17-19-14(3)10-21(17)11-16/h4-5,8,10,16H,6-7,9,11H2,1-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | SULHLVFIHILBPJ-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |