C17H22N2O3 — CID 95738078
(2S,3R)-N-cyclopentyl-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide (PubChem CID 95738078) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S,3R)-N-cyclopentyl-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide.
| Compound Name | (2S,3R)-N-cyclopentyl-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95738078 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2S,3R)-N-cyclopentyl-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide |
| SMILES | CN1C(=O)CO[C@H](C(=O)NC2CCCC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H22N2O3/c1-19-14(20)11-22-16(15(19)12-7-3-2-4-8-12)17(21)18-13-9-5-6-10-13/h2-4,7-8,13,15-16H,5-6,9-11H2,1H3,(H,18,21)/t15-,16+/m1/s1 |
| InChIKey | SOHCPFHSNJIRPP-CVEARBPZSA-N |
| XLogP | 1.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |