C21H22N2O2 — CID 95738529
5-(4-methylphenyl)-N-[(2R)-2-phenylbutyl]-1,2-oxazole-3-carboxamide (PubChem CID 95738529) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-[(2R)-2-phenylbutyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-methylphenyl)-N-[(2R)-2-phenylbutyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 95738529 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5-(4-methylphenyl)-N-[(2R)-2-phenylbutyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC[C@@H](CNC(=O)c1cc(-c2ccc(C)cc2)on1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2/c1-3-16(17-7-5-4-6-8-17)14-22-21(24)19-13-20(25-23-19)18-11-9-15(2)10-12-18/h4-13,16H,3,14H2,1-2H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | CSFGRBQCMSTAJC-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |