About (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide
(2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide (PubChem CID 95738826) has the molecular formula C15H22N2O2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide |
| PubChem CID | 95738826 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCC(=O)N(C)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C15H22N2O2S/c1-4-17(5-2)15(19)11-8-9-13(18)16(3)14(11)12-7-6-10-20-12/h6-7,10-11,14H,4-5,8-9H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | GMMAGYQPSLLZLJ-RISCZKNCSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide?
The IUPAC name of (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide (CID 95738826) is (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide.
What is the SMILES notation for (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide?
The canonical SMILES for (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide is CCN(CC)C(=O)[C@@H]1CCC(=O)N(C)[C@@H]1c1cccs1.
What is the InChIKey of (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide?
The InChIKey is GMMAGYQPSLLZLJ-RISCZKNCSA-N. The full InChI is InChI=1S/C15H22N2O2S/c1-4-17(5-2)15(19)11-8-9-13(18)16(3)14(11)12-7-6-10-20-12/h6-7,10-11,14H,4-5,8-9H2,1-3H3/t11-,14+/m1/s1.
What are the key properties of (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide?
(2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide has a molecular weight of 294.42 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-N,N-diethyl-1-methyl-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide is sourced from PubChem (CID 95738826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).