C21H19ClN2O — CID 95740893
4-chloro-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]benzamide (PubChem CID 95740893) has the molecular formula C21H19ClN2O and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-chloro-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]benzamide.
| Compound Name | 4-chloro-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]benzamide |
|---|---|
| PubChem CID | 95740893 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-chloro-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]benzamide |
| SMILES | Cc1ccc(C)c([C@@H](NC(=O)c2ccc(Cl)cc2)c2cccnc2)c1 |
| InChI | InChI=1S/C21H19ClN2O/c1-14-5-6-15(2)19(12-14)20(17-4-3-11-23-13-17)24-21(25)16-7-9-18(22)10-8-16/h3-13,20H,1-2H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | PVQVXXBASNEYMZ-FQEVSTJZSA-N |
| XLogP | 4.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |