About Tenofovir Alafenamide
Tenofovir Alafenamide (PubChem CID 9574768) has the molecular formula C21H29N6O5P
and a molecular weight of 476.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
Molecular Properties
| Compound Name | Tenofovir Alafenamide |
| PubChem CID | 9574768 |
| Molecular Formula | C21H29N6O5P |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OC[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)OC3=CC=CC=C3 |
| InChI | InChI=1S/C21H29N6O5P/c1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24)/t15-,16+,33+/m1/s1 |
| InChIKey | LDEKQSIMHVQZJK-CAQYMETFSA-N |
| XLogP | 1.90 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | 680 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Tenofovir Alafenamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tenofovir Alafenamide?
The IUPAC name of Tenofovir Alafenamide (CID 9574768) is propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
What is the SMILES notation for Tenofovir Alafenamide?
The canonical SMILES for Tenofovir Alafenamide is C[C@H](CN1C=NC2=C(N=CN=C21)N)OC[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)OC3=CC=CC=C3.
What is the InChIKey of Tenofovir Alafenamide?
The InChIKey is LDEKQSIMHVQZJK-CAQYMETFSA-N. The full InChI is InChI=1S/C21H29N6O5P/c1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24)/t15-,16+,33+/m1/s1.
What are the key properties of Tenofovir Alafenamide?
Tenofovir Alafenamide has a molecular weight of 476.50 g/mol, XLogP of 1.90, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Tenofovir Alafenamide is sourced from PubChem (CID 9574768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).