C12H18F3N5O — CID 95750464
1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one (PubChem CID 95750464) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one.
| Compound Name | 1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 95750464 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
| SMILES | O=C(CCNCC(F)(F)F)N1CCC[C@H](n2cncn2)C1 |
| InChI | InChI=1S/C12H18F3N5O/c13-12(14,15)7-16-4-3-11(21)19-5-1-2-10(6-19)20-9-17-8-18-20/h8-10,16H,1-7H2/t10-/m0/s1 |
| InChIKey | MPQWQZKHSQMDEP-JTQLQIEISA-N |
| XLogP | 0.98 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|