C19H26N4O — CID 95750726
(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]morpholine (PubChem CID 95750726) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]morpholine.
| Compound Name | (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]morpholine |
|---|---|
| PubChem CID | 95750726 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]morpholine |
| SMILES | Cc1nc(C)n(C[C@@H]2CN([C@@H]3CCCc4ccccc43)CCO2)n1 |
| InChI | InChI=1S/C19H26N4O/c1-14-20-15(2)23(21-14)13-17-12-22(10-11-24-17)19-9-5-7-16-6-3-4-8-18(16)19/h3-4,6,8,17,19H,5,7,9-13H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | GZYTYSHDGUADBS-PKOBYXMFSA-N |
| XLogP | 2.67 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |