C13H21F3N4O2 — CID 95750736
(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine (PubChem CID 95750736) has the molecular formula C13H21F3N4O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine.
| Compound Name | (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 95750736 |
| Molecular Formula | C13H21F3N4O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine |
| SMILES | Cc1nc(C)n(C[C@@H]2CN(CCOCC(F)(F)F)CCO2)n1 |
| InChI | InChI=1S/C13H21F3N4O2/c1-10-17-11(2)20(18-10)8-12-7-19(4-6-22-12)3-5-21-9-13(14,15)16/h12H,3-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | UPNXBEVGOVBKTF-LBPRGKRZSA-N |
| XLogP | 1.17 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|