C19H26N4O2 — CID 95751317
N-[[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methyl]-1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine (PubChem CID 95751317) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methyl]-1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine.
| Compound Name | N-[[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methyl]-1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 95751317 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]methyl]-1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
| SMILES | C=C(C)COc1cc(CNC[C@H]2CCc3nncn3C2)ccc1OC |
| InChI | InChI=1S/C19H26N4O2/c1-14(2)12-25-18-8-15(4-6-17(18)24-3)9-20-10-16-5-7-19-22-21-13-23(19)11-16/h4,6,8,13,16,20H,1,5,7,9-12H2,2-3H3/t16-/m1/s1 |
| InChIKey | AJKNNYZMKSCFNP-MRXNPFEDSA-N |
| XLogP | 2.59 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|