About N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide
N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 95754794) has the molecular formula C12H8N6O2S
and a molecular weight of 300.30 g/mol. Its IUPAC name is N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| PubChem CID | 95754794 |
| Molecular Formula | C12H8N6O2S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | N#CCn1ccc(NC(=O)c2cnc3sccn3c2=O)n1 |
| InChI | InChI=1S/C12H8N6O2S/c13-2-4-17-3-1-9(16-17)15-10(19)8-7-14-12-18(11(8)20)5-6-21-12/h1,3,5-7H,4H2,(H,15,16,19) |
| InChIKey | VGGJCSVCZGORHQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The IUPAC name of N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (CID 95754794) is N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
What is the SMILES notation for N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The canonical SMILES for N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide is N#CCn1ccc(NC(=O)c2cnc3sccn3c2=O)n1.
What is the InChIKey of N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The InChIKey is VGGJCSVCZGORHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N6O2S/c13-2-4-17-3-1-9(16-17)15-10(19)8-7-14-12-18(11(8)20)5-6-21-12/h1,3,5-7H,4H2,(H,15,16,19).
What are the key properties of N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide has a molecular weight of 300.30 g/mol, XLogP of 0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(cyanomethyl)pyrazol-3-yl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide is sourced from PubChem (CID 95754794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).