C17H22N6O — CID 95755256
N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-3-(5-methylindazol-1-yl)propanamide (PubChem CID 95755256) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-3-(5-methylindazol-1-yl)propanamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-3-(5-methylindazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95755256 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-3-(5-methylindazol-1-yl)propanamide |
| SMILES | Cc1ccc2c(cnn2CCC(=O)Nc2cc(CN(C)C)[nH]n2)c1 |
| InChI | InChI=1S/C17H22N6O/c1-12-4-5-15-13(8-12)10-18-23(15)7-6-17(24)19-16-9-14(20-21-16)11-22(2)3/h4-5,8-10H,6-7,11H2,1-3H3,(H2,19,20,21,24) |
| InChIKey | TXULVESJVRKMNL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |