C12H18N6O2 — CID 95755260
N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-5-methoxy-1-methylpyrazole-3-carboxamide (PubChem CID 95755260) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-5-methoxy-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-5-methoxy-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95755260 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-1H-pyrazol-3-yl]-5-methoxy-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc(C(=O)Nc2cc(CN(C)C)[nH]n2)nn1C |
| InChI | InChI=1S/C12H18N6O2/c1-17(2)7-8-5-10(15-14-8)13-12(19)9-6-11(20-4)18(3)16-9/h5-6H,7H2,1-4H3,(H2,13,14,15,19) |
| InChIKey | QNHDVMQNVFLXQF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |