C12H23N5O2S — CID 95758078
N,N-dimethyl-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propane-1-sulfonamide (PubChem CID 95758078) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propane-1-sulfonamide.
| Compound Name | N,N-dimethyl-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 95758078 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N,N-dimethyl-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propane-1-sulfonamide |
| SMILES | Cc1nc2n(n1)C[C@@H](NCCCS(=O)(=O)N(C)C)CC2 |
| InChI | InChI=1S/C12H23N5O2S/c1-10-14-12-6-5-11(9-17(12)15-10)13-7-4-8-20(18,19)16(2)3/h11,13H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | ROYBGRROPXLJDE-NSHDSACASA-N |
| XLogP | -0.23 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|