C14H22N6O2 — CID 95758084
5,5-dimethyl-3-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethyl]imidazolidine-2,4-dione (PubChem CID 95758084) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95758084 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5,5-dimethyl-3-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1nc2n(n1)C[C@@H](NCCN1C(=O)NC(C)(C)C1=O)CC2 |
| InChI | InChI=1S/C14H22N6O2/c1-9-16-11-5-4-10(8-20(11)18-9)15-6-7-19-12(21)14(2,3)17-13(19)22/h10,15H,4-8H2,1-3H3,(H,17,22)/t10-/m0/s1 |
| InChIKey | UGADAXZXTSSIAF-JTQLQIEISA-N |
| XLogP | -0.18 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|