About 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile
2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile (PubChem CID 95759744) has the molecular formula C17H19N5
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile.
Molecular Properties
| Compound Name | 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile |
| PubChem CID | 95759744 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile |
| SMILES | C[C@H](NCc1cn2ccccc2c1C#N)[C@@H](C)n1cccn1 |
| InChI | InChI=1S/C17H19N5/c1-13(14(2)22-9-5-7-20-22)19-11-15-12-21-8-4-3-6-17(21)16(15)10-18/h3-9,12-14,19H,11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | DAVLGCZURGFUOA-UONOGXRCSA-N |
| XLogP | 2.75 |
| TPSA | 58.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile?
The IUPAC name of 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile (CID 95759744) is 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile.
What is the SMILES notation for 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile?
The canonical SMILES for 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile is C[C@H](NCc1cn2ccccc2c1C#N)[C@@H](C)n1cccn1.
What is the InChIKey of 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile?
The InChIKey is DAVLGCZURGFUOA-UONOGXRCSA-N. The full InChI is InChI=1S/C17H19N5/c1-13(14(2)22-9-5-7-20-22)19-11-15-12-21-8-4-3-6-17(21)16(15)10-18/h3-9,12-14,19H,11H2,1-2H3/t13-,14+/m0/s1.
What are the key properties of 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile?
2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile has a molecular weight of 293.37 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]methyl]indolizine-1-carbonitrile is sourced from PubChem (CID 95759744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).