C19H23N3O3 — CID 95760026
(3R)-6-ethoxy-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 95760026) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3R)-6-ethoxy-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3R)-6-ethoxy-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 95760026 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3R)-6-ethoxy-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CCOc1ccc2c(c1)C[C@@H](C(=O)N[C@@H]1CCc3nccn3C1)CO2 |
| InChI | InChI=1S/C19H23N3O3/c1-2-24-16-4-5-17-13(10-16)9-14(12-25-17)19(23)21-15-3-6-18-20-7-8-22(18)11-15/h4-5,7-8,10,14-15H,2-3,6,9,11-12H2,1H3,(H,21,23)/t14-,15-/m1/s1 |
| InChIKey | QWWPZRZKJHZHPE-HUUCEWRRSA-N |
| XLogP | 1.96 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |