C16H21N5O2 — CID 95760863
(2S)-1-[3-[(4-cyanophenyl)carbamoylamino]propyl]pyrrolidine-2-carboxamide (PubChem CID 95760863) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (2S)-1-[3-[(4-cyanophenyl)carbamoylamino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3-[(4-cyanophenyl)carbamoylamino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95760863 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (2S)-1-[3-[(4-cyanophenyl)carbamoylamino]propyl]pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)NCCCN2CCC[C@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C16H21N5O2/c17-11-12-4-6-13(7-5-12)20-16(23)19-8-2-10-21-9-1-3-14(21)15(18)22/h4-7,14H,1-3,8-10H2,(H2,18,22)(H2,19,20,23)/t14-/m0/s1 |
| InChIKey | PDLUFXRPKRUVIK-AWEZNQCLSA-N |
| XLogP | 1.02 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|