About 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine
2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine (PubChem CID 95761513) has the molecular formula C14H19N5O
and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine.
Molecular Properties
| Compound Name | 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine |
| PubChem CID | 95761513 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine |
| SMILES | C[C@H]1C[C@H]1c1ccc(C/N=C(\N)Nc2cnn(C)c2)o1 |
| InChI | InChI=1S/C14H19N5O/c1-9-5-12(9)13-4-3-11(20-13)7-16-14(15)18-10-6-17-19(2)8-10/h3-4,6,8-9,12H,5,7H2,1-2H3,(H3,15,16,18)/t9-,12+/m0/s1 |
| InChIKey | WFUVBGVOGCMDEI-JOYOIKCWSA-N |
| XLogP | 2.06 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine?
The IUPAC name of 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine (CID 95761513) is 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine.
What is the SMILES notation for 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine?
The canonical SMILES for 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine is C[C@H]1C[C@H]1c1ccc(C/N=C(\N)Nc2cnn(C)c2)o1.
What is the InChIKey of 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine?
The InChIKey is WFUVBGVOGCMDEI-JOYOIKCWSA-N. The full InChI is InChI=1S/C14H19N5O/c1-9-5-12(9)13-4-3-11(20-13)7-16-14(15)18-10-6-17-19(2)8-10/h3-4,6,8-9,12H,5,7H2,1-2H3,(H3,15,16,18)/t9-,12+/m0/s1.
What are the key properties of 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine?
2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine has a molecular weight of 273.34 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methyl]-1-(1-methylpyrazol-4-yl)guanidine is sourced from PubChem (CID 95761513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).