About N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide
N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide (PubChem CID 95761552) has the molecular formula C12H21F3N4
and a molecular weight of 278.32 g/mol. Its IUPAC name is N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
| PubChem CID | 95761552 |
| Molecular Formula | C12H21F3N4 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\[C@H]1CCN(CC(F)(F)F)C1)N1CCCCC1 |
| InChI | InChI=1S/C12H21F3N4/c13-12(14,15)9-18-7-4-10(8-18)17-11(16)19-5-2-1-3-6-19/h10H,1-9H2,(H2,16,17)/t10-/m0/s1 |
| InChIKey | LHPYXJJYXYNXGT-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide?
The IUPAC name of N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide (CID 95761552) is N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide.
What is the SMILES notation for N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide?
The canonical SMILES for N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide is N/C(=N\[C@H]1CCN(CC(F)(F)F)C1)N1CCCCC1.
What is the InChIKey of N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide?
The InChIKey is LHPYXJJYXYNXGT-JTQLQIEISA-N. The full InChI is InChI=1S/C12H21F3N4/c13-12(14,15)9-18-7-4-10(8-18)17-11(16)19-5-2-1-3-6-19/h10H,1-9H2,(H2,16,17)/t10-/m0/s1.
What are the key properties of N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide?
N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide has a molecular weight of 278.32 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide is sourced from PubChem (CID 95761552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).