C21H22N2O2 — CID 95761896
cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 95761896) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 95761896 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | O=C(OC1CCCC1)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O2/c24-21(25-18-13-7-8-14-18)19-15-20(16-9-3-1-4-10-16)23(22-19)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2/t20-/m1/s1 |
| InChIKey | WLEAJXAGTUAKPC-HXUWFJFHSA-N |
| XLogP | 4.48 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |