About cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate
cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 95761896) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate.
Molecular Properties
| Compound Name | cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
| PubChem CID | 95761896 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | O=C(OC1CCCC1)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O2/c24-21(25-18-13-7-8-14-18)19-15-20(16-9-3-1-4-10-16)23(22-19)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2/t20-/m1/s1 |
| InChIKey | WLEAJXAGTUAKPC-HXUWFJFHSA-N |
| XLogP | 4.48 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate?
The IUPAC name of cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate (CID 95761896) is cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate.
What is the SMILES notation for cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate?
The canonical SMILES for cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate is O=C(OC1CCCC1)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1.
What is the InChIKey of cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate?
The InChIKey is WLEAJXAGTUAKPC-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H22N2O2/c24-21(25-18-13-7-8-14-18)19-15-20(16-9-3-1-4-10-16)23(22-19)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2/t20-/m1/s1.
What are the key properties of cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate?
cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate has a molecular weight of 334.42 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl (3R)-2,3-diphenyl-3,4-dihydropyrazole-5-carboxylate is sourced from PubChem (CID 95761896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).