C17H26N2O3S — CID 95762384
1-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-1-one (PubChem CID 95762384) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-1-one.
| Compound Name | 1-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-1-one |
|---|---|
| PubChem CID | 95762384 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(2R)-2-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-1-one |
| SMILES | Cc1csc([C@H]2CCCCN2C(=O)CCOC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C17H26N2O3S/c1-13-12-23-17(18-13)15-6-2-3-8-19(15)16(20)7-10-21-11-14-5-4-9-22-14/h12,14-15H,2-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | JVBDOBFGSLKTBA-LSDHHAIUSA-N |
| XLogP | 3.09 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|