C18H26N4O3 — CID 95762740
(2S)-N-[(1R)-1-(3-nitrophenyl)ethyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 95762740) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(3-nitrophenyl)ethyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[(1R)-1-(3-nitrophenyl)ethyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95762740 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2S)-N-[(1R)-1-(3-nitrophenyl)ethyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCC[C@H]1CN1CCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N4O3/c1-14(15-6-4-7-16(12-15)22(24)25)19-18(23)21-11-5-8-17(21)13-20-9-2-3-10-20/h4,6-7,12,14,17H,2-3,5,8-11,13H2,1H3,(H,19,23)/t14-,17+/m1/s1 |
| InChIKey | GKGNYMLIFJLCDY-PBHICJAKSA-N |
| XLogP | 2.93 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|