C19H22N2O2 — CID 95763013
2-methyl-N-[2-oxo-2-[[(1S)-1-phenylpropyl]amino]ethyl]benzamide (PubChem CID 95763013) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-[[(1S)-1-phenylpropyl]amino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[2-oxo-2-[[(1S)-1-phenylpropyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 95763013 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-[[(1S)-1-phenylpropyl]amino]ethyl]benzamide |
| SMILES | CC[C@H](NC(=O)CNC(=O)c1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-17(15-10-5-4-6-11-15)21-18(22)13-20-19(23)16-12-8-7-9-14(16)2/h4-12,17H,3,13H2,1-2H3,(H,20,23)(H,21,22)/t17-/m0/s1 |
| InChIKey | SLIQZUZEMNOAAN-KRWDZBQOSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |