C15H19ClN2O3S — CID 95763389
[(3R)-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]methanesulfonamide (PubChem CID 95763389) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is [(3R)-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | [(3R)-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 95763389 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [(3R)-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)C[C@@H]1CCCN(C(=O)/C=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H19ClN2O3S/c16-14-6-3-12(4-7-14)5-8-15(19)18-9-1-2-13(10-18)11-22(17,20)21/h3-8,13H,1-2,9-11H2,(H2,17,20,21)/b8-5+/t13-/m1/s1 |
| InChIKey | UBMOZTCFMBJBNR-OQHXTRMZSA-N |
| XLogP | 1.88 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|