C16H22N4OS — CID 95763960
[(2R)-1-[6-[(5-ethylthiophen-2-yl)methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 95763960) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is [(2R)-1-[6-[(5-ethylthiophen-2-yl)methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[6-[(5-ethylthiophen-2-yl)methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 95763960 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2R)-1-[6-[(5-ethylthiophen-2-yl)methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | CCc1ccc(CNc2cc(N3CCC[C@@H]3CO)ncn2)s1 |
| InChI | InChI=1S/C16H22N4OS/c1-2-13-5-6-14(22-13)9-17-15-8-16(19-11-18-15)20-7-3-4-12(20)10-21/h5-6,8,11-12,21H,2-4,7,9-10H2,1H3,(H,17,18,19)/t12-/m1/s1 |
| InChIKey | RGFOZUYQDGSXCR-GFCCVEGCSA-N |
| XLogP | 2.67 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |