C19H26N4O2 — CID 95764108
[(2R)-1-[6-[2-(2-methoxyphenyl)ethyl-methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 95764108) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(2R)-1-[6-[2-(2-methoxyphenyl)ethyl-methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[6-[2-(2-methoxyphenyl)ethyl-methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 95764108 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [(2R)-1-[6-[2-(2-methoxyphenyl)ethyl-methylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1ccccc1CCN(C)c1cc(N2CCC[C@@H]2CO)ncn1 |
| InChI | InChI=1S/C19H26N4O2/c1-22(11-9-15-6-3-4-8-17(15)25-2)18-12-19(21-14-20-18)23-10-5-7-16(23)13-24/h3-4,6,8,12,14,16,24H,5,7,9-11,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | GLADUIPFDQHPMN-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |