About (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide
(3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 95764727) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide |
| PubChem CID | 95764727 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN1C[C@H](C(=O)NCc2c(C)cc(C)[nH]c2=O)CC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-4-18-8-11(6-13(18)19)14(20)16-7-12-9(2)5-10(3)17-15(12)21/h5,11H,4,6-8H2,1-3H3,(H,16,20)(H,17,21)/t11-/m1/s1 |
| InChIKey | HXLGKVZPQWUTAI-LLVKDONJSA-N |
| XLogP | 0.48 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide?
The IUPAC name of (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide (CID 95764727) is (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide?
The canonical SMILES for (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide is CCN1C[C@H](C(=O)NCc2c(C)cc(C)[nH]c2=O)CC1=O.
What is the InChIKey of (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide?
The InChIKey is HXLGKVZPQWUTAI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-4-18-8-11(6-13(18)19)14(20)16-7-12-9(2)5-10(3)17-15(12)21/h5,11H,4,6-8H2,1-3H3,(H,16,20)(H,17,21)/t11-/m1/s1.
What are the key properties of (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide?
(3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide has a molecular weight of 291.35 g/mol, XLogP of 0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-ethyl-5-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 95764727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).