C13H18F3N3OS — CID 95770149
1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one (PubChem CID 95770149) has the molecular formula C13H18F3N3OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one.
| Compound Name | 1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 95770149 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
| SMILES | O=C(CCNCC(F)(F)F)N1CCCC[C@H]1c1nccs1 |
| InChI | InChI=1S/C13H18F3N3OS/c14-13(15,16)9-17-5-4-11(20)19-7-2-1-3-10(19)12-18-6-8-21-12/h6,8,10,17H,1-5,7,9H2/t10-/m0/s1 |
| InChIKey | XEGLDYUJFCXQMI-JTQLQIEISA-N |
| XLogP | 2.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|