About N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine
N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine (PubChem CID 95770305) has the molecular formula C17H28N4O3
and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine.
Molecular Properties
| Compound Name | N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine |
| PubChem CID | 95770305 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine |
| SMILES | CCOCCCN1CC[C@@H](Nc2ncc([N+](=O)[O-])cc2C)[C@H](C)C1 |
| InChI | InChI=1S/C17H28N4O3/c1-4-24-9-5-7-20-8-6-16(14(3)12-20)19-17-13(2)10-15(11-18-17)21(22)23/h10-11,14,16H,4-9,12H2,1-3H3,(H,18,19)/t14-,16-/m1/s1 |
| InChIKey | AYFLDVMVFUWDAK-GDBMZVCRSA-N |
| XLogP | 2.85 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine?
The IUPAC name of N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine (CID 95770305) is N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine.
What is the SMILES notation for N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine?
The canonical SMILES for N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine is CCOCCCN1CC[C@@H](Nc2ncc([N+](=O)[O-])cc2C)[C@H](C)C1.
What is the InChIKey of N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine?
The InChIKey is AYFLDVMVFUWDAK-GDBMZVCRSA-N. The full InChI is InChI=1S/C17H28N4O3/c1-4-24-9-5-7-20-8-6-16(14(3)12-20)19-17-13(2)10-15(11-18-17)21(22)23/h10-11,14,16H,4-9,12H2,1-3H3,(H,18,19)/t14-,16-/m1/s1.
What are the key properties of N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine?
N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine has a molecular weight of 336.44 g/mol, XLogP of 2.85, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-3-methyl-5-nitropyridin-2-amine is sourced from PubChem (CID 95770305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).