C17H19N3OS — CID 95771455
(3S)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 95771455) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (3S)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | (3S)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 95771455 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (3S)-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cn2c(n1)CC[C@H](NC(=O)[C@H]1CSc3ccccc31)C2 |
| InChI | InChI=1S/C17H19N3OS/c1-11-8-20-9-12(6-7-16(20)18-11)19-17(21)14-10-22-15-5-3-2-4-13(14)15/h2-5,8,12,14H,6-7,9-10H2,1H3,(H,19,21)/t12-,14-/m0/s1 |
| InChIKey | RVUQJNGQMPYWDU-JSGCOSHPSA-N |
| XLogP | 2.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |