C11H18N4OS — CID 95772253
1-[(2R,6R)-2,6-dimethylcyclohexyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 95772253) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-[(2R,6R)-2,6-dimethylcyclohexyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(2R,6R)-2,6-dimethylcyclohexyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 95772253 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(2R,6R)-2,6-dimethylcyclohexyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | C[C@@H]1CCC[C@@H](C)C1NC(=O)Nc1nncs1 |
| InChI | InChI=1S/C11H18N4OS/c1-7-4-3-5-8(2)9(7)13-10(16)14-11-15-12-6-17-11/h6-9H,3-5H2,1-2H3,(H2,13,14,15,16)/t7-,8-/m1/s1 |
| InChIKey | RXWOXOCINSZTDU-HTQZYQBOSA-N |
| XLogP | 2.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |