C17H29N5O5 — CID 95772400
tert-butyl (4S,5S)-4-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 95772400) has the molecular formula C17H29N5O5 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 95772400 |
| Molecular Formula | C17H29N5O5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl (4S,5S)-4-[[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | Cc1nn(C)c(NC[C@H]2[C@H](C)OC(C)(C)N2C(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H29N5O5/c1-10-13(22(24)25)14(20(8)19-10)18-9-12-11(2)26-17(6,7)21(12)15(23)27-16(3,4)5/h11-12,18H,9H2,1-8H3/t11-,12-/m0/s1 |
| InChIKey | OGOVYHJEFHIJTQ-RYUDHWBXSA-N |
| XLogP | 2.81 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|